C6H10BrN — CID 98071510
(1R,4S,7S)-7-bromo-2-azabicyclo[2.2.1]heptane (PubChem CID 98071510) has the molecular formula C6H10BrN and a molecular weight of 176.06 g/mol. Its IUPAC name is (1R,4S,7S)-7-bromo-2-azabicyclo[2.2.1]heptane.
| Compound Name | (1R,4S,7S)-7-bromo-2-azabicyclo[2.2.1]heptane |
|---|---|
| PubChem CID | 98071510 |
| Molecular Formula | C6H10BrN |
| Molecular Weight | 176.06 g/mol |
| Exact Mass | 175.00 |
| IUPAC Name | (1R,4S,7S)-7-bromo-2-azabicyclo[2.2.1]heptane |
| SMILES | Br[C@H]1[C@H]2CC[C@H]1NC2 |
| InChI | InChI=1S/C6H10BrN/c7-6-4-1-2-5(6)8-3-4/h4-6,8H,1-3H2/t4-,5+,6-/m0/s1 |
| InChIKey | RNAJUDJSHSNSBR-JKUQZMGJSA-N |
| XLogP | 1.13 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.06 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|