C6H11N — CID 168742834
(1R,4S)-5-methyl-2-azabicyclo[2.1.1]hexane (PubChem CID 168742834) has the molecular formula C6H11N and a molecular weight of 97.16 g/mol. Its IUPAC name is (1R,4S)-5-methyl-2-azabicyclo[2.1.1]hexane.
| Compound Name | (1R,4S)-5-methyl-2-azabicyclo[2.1.1]hexane |
|---|---|
| PubChem CID | 168742834 |
| Molecular Formula | C6H11N |
| Molecular Weight | 97.16 g/mol |
| Exact Mass | 97.09 |
| IUPAC Name | (1R,4S)-5-methyl-2-azabicyclo[2.1.1]hexane |
| SMILES | CC1[C@H]2CN[C@@H]1C2 |
| InChI | InChI=1S/C6H11N/c1-4-5-2-6(4)7-3-5/h4-7H,2-3H2,1H3/t4?,5-,6-/m1/s1 |
| InChIKey | MUNJHJGJKLXZCX-YSLANXFLSA-N |
| XLogP | 0.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 97.16 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |