About 6-azatricyclo[3.2.1.03,8]octane
6-azatricyclo[3.2.1.03,8]octane (PubChem CID 129230389) has the molecular formula C7H11N
and a molecular weight of 109.17 g/mol. Its IUPAC name is 6-azatricyclo[3.2.1.03,8]octane.
Molecular Properties
| Compound Name | 6-azatricyclo[3.2.1.03,8]octane |
| PubChem CID | 129230389 |
| Molecular Formula | C7H11N |
| Molecular Weight | 109.17 g/mol |
| Exact Mass | 109.09 |
| IUPAC Name | 6-azatricyclo[3.2.1.03,8]octane |
| SMILES | C1NC2CC3CC1C32 |
| InChI | InChI=1S/C7H11N/c1-4-2-6-7(4)5(1)3-8-6/h4-8H,1-3H2 |
| InChIKey | RYAKHUXUWJBLLM-UHFFFAOYSA-N |
| XLogP | 0.61 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 109.17 |
| LogP ≤ 5 | 0.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 6-azatricyclo[3.2.1.03,8]octane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-azatricyclo[3.2.1.03,8]octane?
The IUPAC name of 6-azatricyclo[3.2.1.03,8]octane (CID 129230389) is 6-azatricyclo[3.2.1.03,8]octane.
What is the SMILES notation for 6-azatricyclo[3.2.1.03,8]octane?
The canonical SMILES for 6-azatricyclo[3.2.1.03,8]octane is C1NC2CC3CC1C32.
What is the InChIKey of 6-azatricyclo[3.2.1.03,8]octane?
The InChIKey is RYAKHUXUWJBLLM-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11N/c1-4-2-6-7(4)5(1)3-8-6/h4-8H,1-3H2.
What are the key properties of 6-azatricyclo[3.2.1.03,8]octane?
6-azatricyclo[3.2.1.03,8]octane has a molecular weight of 109.17 g/mol, XLogP of 0.61, 0 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 6-azatricyclo[3.2.1.03,8]octane is sourced from PubChem (CID 129230389), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).