C4H7N — CID 29082085
(1S,4S)-2-azabicyclo[2.1.0]pentane (PubChem CID 29082085) has the molecular formula C4H7N and a molecular weight of 69.11 g/mol. Its IUPAC name is (1S,4S)-2-azabicyclo[2.1.0]pentane.
| Compound Name | (1S,4S)-2-azabicyclo[2.1.0]pentane |
|---|---|
| PubChem CID | 29082085 |
| Molecular Formula | C4H7N |
| Molecular Weight | 69.11 g/mol |
| Exact Mass | 69.06 |
| IUPAC Name | (1S,4S)-2-azabicyclo[2.1.0]pentane |
| SMILES | C1N[C@H]2C[C@@H]12 |
| InChI | InChI=1S/C4H7N/c1-3-2-5-4(1)3/h3-5H,1-2H2/t3-,4-/m0/s1 |
| InChIKey | DAPJDNAXUNPBRZ-IMJSIDKUSA-N |
| XLogP | -0.02 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 69.11 |
| LogP ≤ 5 | -0.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |