C9H15N — CID 55288326
(2R,6S,8S)-4-azatricyclo[4.4.0.02,8]decane (PubChem CID 55288326) has the molecular formula C9H15N and a molecular weight of 137.23 g/mol. Its IUPAC name is (2R,6S,8S)-4-azatricyclo[4.4.0.02,8]decane.
| Compound Name | (2R,6S,8S)-4-azatricyclo[4.4.0.02,8]decane |
|---|---|
| PubChem CID | 55288326 |
| Molecular Formula | C9H15N |
| Molecular Weight | 137.23 g/mol |
| Exact Mass | 137.12 |
| IUPAC Name | (2R,6S,8S)-4-azatricyclo[4.4.0.02,8]decane |
| SMILES | C1C[C@H]2C[C@@H]3CNC[C@H]2C13 |
| InChI | InChI=1S/C9H15N/c1-2-8-7-3-6(1)9(8)5-10-4-7/h6-10H,1-5H2/t6-,7+,8?,9+/m0/s1 |
| InChIKey | KXTKSIJSKZAUJG-QRDCSKFFSA-N |
| XLogP | 1.25 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 137.23 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |