C10H17N — CID 170152236
(3aR)-2,3,3a,3b,4,5,6,6a,7,7a-decahydro-1H-pentaleno[1,2-c]pyrrole (PubChem CID 170152236) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (3aR)-2,3,3a,3b,4,5,6,6a,7,7a-decahydro-1H-pentaleno[1,2-c]pyrrole.
| Compound Name | (3aR)-2,3,3a,3b,4,5,6,6a,7,7a-decahydro-1H-pentaleno[1,2-c]pyrrole |
|---|---|
| PubChem CID | 170152236 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (3aR)-2,3,3a,3b,4,5,6,6a,7,7a-decahydro-1H-pentaleno[1,2-c]pyrrole |
| SMILES | C1CC2CC3CNC[C@@H]3C2C1 |
| InChI | InChI=1S/C10H17N/c1-2-7-4-8-5-11-6-10(8)9(7)3-1/h7-11H,1-6H2/t7?,8?,9?,10-/m0/s1 |
| InChIKey | FYMHZSCOLNJVTH-VVIYDGDNSA-N |
| XLogP | 1.64 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 1.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |