C5H7NS — CID 131863057
3-thia-6-azatricyclo[3.2.0.02,4]heptane (PubChem CID 131863057) has the molecular formula C5H7NS and a molecular weight of 113.18 g/mol. Its IUPAC name is 3-thia-6-azatricyclo[3.2.0.02,4]heptane.
| Compound Name | 3-thia-6-azatricyclo[3.2.0.02,4]heptane |
|---|---|
| PubChem CID | 131863057 |
| Molecular Formula | C5H7NS |
| Molecular Weight | 113.18 g/mol |
| Exact Mass | 113.03 |
| IUPAC Name | 3-thia-6-azatricyclo[3.2.0.02,4]heptane |
| SMILES | C1NC2C1C1SC21 |
| InChI | InChI=1S/C5H7NS/c1-2-3(6-1)5-4(2)7-5/h2-6H,1H2 |
| InChIKey | HWGNHVVZPQGBIB-UHFFFAOYSA-N |
| XLogP | 0.07 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 113.18 |
| LogP ≤ 5 | 0.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|