C12H21NO2 — CID 102894030
3-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)oxan-4-ol (PubChem CID 102894030) has the molecular formula C12H21NO2 and a molecular weight of 211.30 g/mol. Its IUPAC name is 3-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)oxan-4-ol.
| Compound Name | 3-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)oxan-4-ol |
|---|---|
| PubChem CID | 102894030 |
| Molecular Formula | C12H21NO2 |
| Molecular Weight | 211.30 g/mol |
| Exact Mass | 211.16 |
| IUPAC Name | 3-(1,2,3,3a,4,5,6,6a-octahydrocyclopenta[c]pyrrol-3-yl)oxan-4-ol |
| SMILES | OC1CCOCC1C1NCC2CCCC21 |
| InChI | InChI=1S/C12H21NO2/c14-11-4-5-15-7-10(11)12-9-3-1-2-8(9)6-13-12/h8-14H,1-7H2 |
| InChIKey | NIRRWJLZYYDHDO-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 41.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.30 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |