C10H18O5 — CID 22887334
3,6,10-trioxabicyclo[6.5.0]tridecane-7,13-diol (PubChem CID 22887334) has the molecular formula C10H18O5 and a molecular weight of 218.25 g/mol. Its IUPAC name is 3,6,10-trioxabicyclo[6.5.0]tridecane-7,13-diol.
| Compound Name | 3,6,10-trioxabicyclo[6.5.0]tridecane-7,13-diol |
|---|---|
| PubChem CID | 22887334 |
| Molecular Formula | C10H18O5 |
| Molecular Weight | 218.25 g/mol |
| Exact Mass | 218.12 |
| IUPAC Name | 3,6,10-trioxabicyclo[6.5.0]tridecane-7,13-diol |
| SMILES | OC1CCOCC2C(O)OCCOCC12 |
| InChI | InChI=1S/C10H18O5/c11-9-1-2-13-6-8-7(9)5-14-3-4-15-10(8)12/h7-12H,1-6H2 |
| InChIKey | LEVJVIDVFYMWRX-UHFFFAOYSA-N |
| XLogP | -0.63 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.25 |
| LogP ≤ 5 | -0.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |