C6H10INO3 — CID 122536495
N-[(3S,4S)-4-hydroxyoxan-3-yl]carbamoyl iodide (PubChem CID 122536495) has the molecular formula C6H10INO3 and a molecular weight of 271.05 g/mol. Its IUPAC name is N-[(3S,4S)-4-hydroxyoxan-3-yl]carbamoyl iodide.
| Compound Name | N-[(3S,4S)-4-hydroxyoxan-3-yl]carbamoyl iodide |
|---|---|
| PubChem CID | 122536495 |
| Molecular Formula | C6H10INO3 |
| Molecular Weight | 271.05 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | N-[(3S,4S)-4-hydroxyoxan-3-yl]carbamoyl iodide |
| SMILES | O=C(I)N[C@H]1COCC[C@@H]1O |
| InChI | InChI=1S/C6H10INO3/c7-6(10)8-4-3-11-2-1-5(4)9/h4-5,9H,1-3H2,(H,8,10)/t4-,5-/m0/s1 |
| InChIKey | AWGMNZGCEJUKSM-WHFBIAKZSA-N |
| XLogP | 0.28 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.05 |
| LogP ≤ 5 | 0.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|