C18H24N2O3 — CID 91773534
N-[(3R,4R)-4-hydroxyoxan-3-yl]-2-(2,4,7-trimethyl-1H-indol-3-yl)acetamide (PubChem CID 91773534) has the molecular formula C18H24N2O3 and a molecular weight of 316.40 g/mol. Its IUPAC name is N-[(3R,4R)-4-hydroxyoxan-3-yl]-2-(2,4,7-trimethyl-1H-indol-3-yl)acetamide.
| Compound Name | N-[(3R,4R)-4-hydroxyoxan-3-yl]-2-(2,4,7-trimethyl-1H-indol-3-yl)acetamide |
|---|---|
| PubChem CID | 91773534 |
| Molecular Formula | C18H24N2O3 |
| Molecular Weight | 316.40 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-[(3R,4R)-4-hydroxyoxan-3-yl]-2-(2,4,7-trimethyl-1H-indol-3-yl)acetamide |
| SMILES | Cc1[nH]c2c(C)ccc(C)c2c1CC(=O)N[C@@H]1COCC[C@H]1O |
| InChI | InChI=1S/C18H24N2O3/c1-10-4-5-11(2)18-17(10)13(12(3)19-18)8-16(22)20-14-9-23-7-6-15(14)21/h4-5,14-15,19,21H,6-9H2,1-3H3,(H,20,22)/t14-,15-/m1/s1 |
| InChIKey | CUYNDFVSBCGJJG-HUUCEWRRSA-N |
| XLogP | 1.90 |
| TPSA | 74.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.40 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |