C9H12O2 — CID 142096051
4-ethylcyclohepta-2,4,6-triene-1,2-diol (PubChem CID 142096051) has the molecular formula C9H12O2 and a molecular weight of 152.19 g/mol. Its IUPAC name is 4-ethylcyclohepta-2,4,6-triene-1,2-diol.
| Compound Name | 4-ethylcyclohepta-2,4,6-triene-1,2-diol |
|---|---|
| PubChem CID | 142096051 |
| Molecular Formula | C9H12O2 |
| Molecular Weight | 152.19 g/mol |
| Exact Mass | 152.08 |
| IUPAC Name | 4-ethylcyclohepta-2,4,6-triene-1,2-diol |
| SMILES | CCC1=CC=CC(O)C(O)=C1 |
| InChI | InChI=1S/C9H12O2/c1-2-7-4-3-5-8(10)9(11)6-7/h3-6,8,10-11H,2H2,1H3 |
| InChIKey | ZJOQVCJEHYGSCS-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.19 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |