C14H22 — CID 142904411
3-ethyl-1-pentan-2-ylcyclohepta-1,3,5-triene (PubChem CID 142904411) has the molecular formula C14H22 and a molecular weight of 190.33 g/mol. Its IUPAC name is 3-ethyl-1-pentan-2-ylcyclohepta-1,3,5-triene.
| Compound Name | 3-ethyl-1-pentan-2-ylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 142904411 |
| Molecular Formula | C14H22 |
| Molecular Weight | 190.33 g/mol |
| Exact Mass | 190.17 |
| IUPAC Name | 3-ethyl-1-pentan-2-ylcyclohepta-1,3,5-triene |
| SMILES | CCCC(C)C1=CC(CC)=CC=CC1 |
| InChI | InChI=1S/C14H22/c1-4-8-12(3)14-10-7-6-9-13(5-2)11-14/h6-7,9,11-12H,4-5,8,10H2,1-3H3 |
| InChIKey | OUJGHKNJLKWPSK-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.33 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |