About 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium
1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium (PubChem CID 173316758) has the molecular formula C14H18Zr
and a molecular weight of 277.52 g/mol. Its IUPAC name is 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium.
Molecular Properties
| Compound Name | 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium |
| PubChem CID | 173316758 |
| Molecular Formula | C14H18Zr |
| Molecular Weight | 277.52 g/mol |
| Exact Mass | 276.05 |
| IUPAC Name | 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium |
| SMILES | CCCC(C1=CC=CC1)C1=CC=CC1.[Zr] |
| InChI | InChI=1S/C14H18.Zr/c1-2-7-14(12-8-3-4-9-12)13-10-5-6-11-13;/h3-6,8,10,14H,2,7,9,11H2,1H3; |
| InChIKey | FMMKKPWDQLIRDC-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 277.52 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium?
The IUPAC name of 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium (CID 173316758) is 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium.
What is the SMILES notation for 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium?
The canonical SMILES for 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium is CCCC(C1=CC=CC1)C1=CC=CC1.[Zr].
What is the InChIKey of 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium?
The InChIKey is FMMKKPWDQLIRDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18.Zr/c1-2-7-14(12-8-3-4-9-12)13-10-5-6-11-13;/h3-6,8,10,14H,2,7,9,11H2,1H3;.
What are the key properties of 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium?
1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium has a molecular weight of 277.52 g/mol, XLogP of 4.17, 4 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-cyclopenta-1,3-dien-1-ylbutyl)cyclopenta-1,3-diene;zirconium is sourced from PubChem (CID 173316758), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).