C24H40O3Zr — CID 173370282
tris(butan-1-olate);1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+) (PubChem CID 173370282) has the molecular formula C24H40O3Zr and a molecular weight of 467.81 g/mol. Its IUPAC name is tris(butan-1-olate);1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+).
| Compound Name | tris(butan-1-olate);1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+) |
|---|---|
| PubChem CID | 173370282 |
| Molecular Formula | C24H40O3Zr |
| Molecular Weight | 467.81 g/mol |
| Exact Mass | 466.20 |
| IUPAC Name | tris(butan-1-olate);1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+) |
| SMILES | CCCC[O-].CCCC[O-].CCCC[O-].[CH2-]C(C1=CC=CC1)C1=CC=CC1.[Zr+4] |
| InChI | InChI=1S/C12H13.3C4H9O.Zr/c1-10(11-6-2-3-7-11)12-8-4-5-9-12;3*1-2-3-4-5;/h2-6,8,10H,1,7,9H2;3*2-4H2,1H3;/q4*-1;+4 |
| InChIKey | FDDIOUGLXDAJEU-UHFFFAOYSA-N |
| XLogP | 3.65 |
| TPSA | 69.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.81 |
| LogP ≤ 5 | 3.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|