C18H32O — CID 23569005
1-cyclopenta-1,3-dien-1-yltridecan-1-ol (PubChem CID 23569005) has the molecular formula C18H32O and a molecular weight of 264.45 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yltridecan-1-ol.
| Compound Name | 1-cyclopenta-1,3-dien-1-yltridecan-1-ol |
|---|---|
| PubChem CID | 23569005 |
| Molecular Formula | C18H32O |
| Molecular Weight | 264.45 g/mol |
| Exact Mass | 264.25 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yltridecan-1-ol |
| SMILES | CCCCCCCCCCCCC(O)C1=CC=CC1 |
| InChI | InChI=1S/C18H32O/c1-2-3-4-5-6-7-8-9-10-11-16-18(19)17-14-12-13-15-17/h12-14,18-19H,2-11,15-16H2,1H3 |
| InChIKey | ORYCEHAIUPAFSB-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.45 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|