C15H26O — CID 66772825
1-[1-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene (PubChem CID 66772825) has the molecular formula C15H26O and a molecular weight of 222.37 g/mol. Its IUPAC name is 1-[1-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene.
| Compound Name | 1-[1-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 66772825 |
| Molecular Formula | C15H26O |
| Molecular Weight | 222.37 g/mol |
| Exact Mass | 222.20 |
| IUPAC Name | 1-[1-[(2-methylpropan-2-yl)oxy]hexyl]cyclopenta-1,3-diene |
| SMILES | CCCCCC(OC(C)(C)C)C1=CC=CC1 |
| InChI | InChI=1S/C15H26O/c1-5-6-7-12-14(16-15(2,3)4)13-10-8-9-11-13/h8-10,14H,5-7,11-12H2,1-4H3 |
| InChIKey | UWBNGYQFAUPUAR-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.37 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|