C18H30O — CID 67242376
2-dodecylcyclohexa-2,4-dien-1-one (PubChem CID 67242376) has the molecular formula C18H30O and a molecular weight of 262.44 g/mol. Its IUPAC name is 2-dodecylcyclohexa-2,4-dien-1-one.
| Compound Name | 2-dodecylcyclohexa-2,4-dien-1-one |
|---|---|
| PubChem CID | 67242376 |
| Molecular Formula | C18H30O |
| Molecular Weight | 262.44 g/mol |
| Exact Mass | 262.23 |
| IUPAC Name | 2-dodecylcyclohexa-2,4-dien-1-one |
| SMILES | CCCCCCCCCCCCC1=CC=CCC1=O |
| InChI | InChI=1S/C18H30O/c1-2-3-4-5-6-7-8-9-10-11-14-17-15-12-13-16-18(17)19/h12-13,15H,2-11,14,16H2,1H3 |
| InChIKey | CZCGCRANBPLWGG-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.44 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|