C19H33NO2 — CID 15598201
3-Pentadecylpyrrole-2,5-dione (PubChem CID 15598201) has the molecular formula C19H33NO2 and a molecular weight of 307.50 g/mol. Its IUPAC name is 3-pentadecylpyrrole-2,5-dione.
| Compound Name | 3-Pentadecylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 15598201 |
| Molecular Formula | C19H33NO2 |
| Molecular Weight | 307.50 g/mol |
| Exact Mass | 307.25 |
| IUPAC Name | 3-pentadecylpyrrole-2,5-dione |
| SMILES | CCCCCCCCCCCCCCCC1=CC(=O)NC1=O |
| InChI | InChI=1S/C19H33NO2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-17-16-18(21)20-19(17)22/h16H,2-15H2,1H3,(H,20,21,22) |
| InChIKey | GVZAFEZGCYWCNM-UHFFFAOYSA-N |
| XLogP | 7.10 |
| TPSA | 46.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | 360 |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.50 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|