C16H22N2O4 — CID 159512503
3-butylpyrrole-2,5-dione (PubChem CID 159512503) has the molecular formula C16H22N2O4 and a molecular weight of 306.36 g/mol. Its IUPAC name is 3-butylpyrrole-2,5-dione.
| Compound Name | 3-butylpyrrole-2,5-dione |
|---|---|
| PubChem CID | 159512503 |
| Molecular Formula | C16H22N2O4 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.16 |
| IUPAC Name | 3-butylpyrrole-2,5-dione |
| SMILES | CCCCC1=CC(=O)NC1=O.CCCCC1=CC(=O)NC1=O |
| InChI | InChI=1S/2C8H11NO2/c2*1-2-3-4-6-5-7(10)9-8(6)11/h2*5H,2-4H2,1H3,(H,9,10,11) |
| InChIKey | MATWHHLDJOPJNQ-UHFFFAOYSA-N |
| XLogP | 1.52 |
| TPSA | 92.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|