C12H13Cl3Zr — CID 173014987
1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride (PubChem CID 173014987) has the molecular formula C12H13Cl3Zr and a molecular weight of 354.82 g/mol. Its IUPAC name is 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride.
| Compound Name | 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride |
|---|---|
| PubChem CID | 173014987 |
| Molecular Formula | C12H13Cl3Zr |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride |
| SMILES | [CH2-]C(C1=CC=CC1)C1=CC=CC1.[Cl-].[Cl-].[Cl-].[Zr+4] |
| InChI | InChI=1S/C12H13.3ClH.Zr/c1-10(11-6-2-3-7-11)12-8-4-5-9-12;;;;/h2-6,8,10H,1,7,9H2;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | HQXZMXWGJVYGKA-UHFFFAOYSA-K |
| XLogP | -5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | -5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|