About 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride
1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride (PubChem CID 173014987) has the molecular formula C12H13Cl3Zr
and a molecular weight of 354.82 g/mol. Its IUPAC name is 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride.
Molecular Properties
| Compound Name | 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride |
| PubChem CID | 173014987 |
| Molecular Formula | C12H13Cl3Zr |
| Molecular Weight | 354.82 g/mol |
| Exact Mass | 351.91 |
| IUPAC Name | 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride |
| SMILES | [CH2-]C(C1=CC=CC1)C1=CC=CC1.[Cl-].[Cl-].[Cl-].[Zr+4] |
| InChI | InChI=1S/C12H13.3ClH.Zr/c1-10(11-6-2-3-7-11)12-8-4-5-9-12;;;;/h2-6,8,10H,1,7,9H2;3*1H;/q-1;;;;+4/p-3 |
| InChIKey | HQXZMXWGJVYGKA-UHFFFAOYSA-K |
| XLogP | -5.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.82 |
| LogP ≤ 5 | -5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride?
The IUPAC name of 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride (CID 173014987) is 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride.
What is the SMILES notation for 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride?
The canonical SMILES for 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride is [CH2-]C(C1=CC=CC1)C1=CC=CC1.[Cl-].[Cl-].[Cl-].[Zr+4].
What is the InChIKey of 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride?
The InChIKey is HQXZMXWGJVYGKA-UHFFFAOYSA-K. The full InChI is InChI=1S/C12H13.3ClH.Zr/c1-10(11-6-2-3-7-11)12-8-4-5-9-12;;;;/h2-6,8,10H,1,7,9H2;3*1H;/q-1;;;;+4/p-3.
What are the key properties of 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride?
1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride has a molecular weight of 354.82 g/mol, XLogP of -5.78, 2 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-cyclopenta-1,3-dien-1-ylethyl)cyclopenta-1,3-diene;zirconium(4+);trichloride is sourced from PubChem (CID 173014987), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).