C8H13N — CID 12564950
1-cyclopenta-1,3-dien-1-yl-N-methylethanamine (PubChem CID 12564950) has the molecular formula C8H13N and a molecular weight of 123.20 g/mol. Its IUPAC name is 1-cyclopenta-1,3-dien-1-yl-N-methylethanamine.
| Compound Name | 1-cyclopenta-1,3-dien-1-yl-N-methylethanamine |
|---|---|
| PubChem CID | 12564950 |
| Molecular Formula | C8H13N |
| Molecular Weight | 123.20 g/mol |
| Exact Mass | 123.10 |
| IUPAC Name | 1-cyclopenta-1,3-dien-1-yl-N-methylethanamine |
| SMILES | CNC(C)C1=CC=CC1 |
| InChI | InChI=1S/C8H13N/c1-7(9-2)8-5-3-4-6-8/h3-5,7,9H,6H2,1-2H3 |
| InChIKey | QWPHOMWCOFITCG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 123.20 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |