C10H16O — CID 20605412
1-(3-methoxybutan-2-yl)cyclopenta-1,3-diene (PubChem CID 20605412) has the molecular formula C10H16O and a molecular weight of 152.24 g/mol. Its IUPAC name is 1-(3-methoxybutan-2-yl)cyclopenta-1,3-diene.
| Compound Name | 1-(3-methoxybutan-2-yl)cyclopenta-1,3-diene |
|---|---|
| PubChem CID | 20605412 |
| Molecular Formula | C10H16O |
| Molecular Weight | 152.24 g/mol |
| Exact Mass | 152.12 |
| IUPAC Name | 1-(3-methoxybutan-2-yl)cyclopenta-1,3-diene |
| SMILES | COC(C)C(C)C1=CC=CC1 |
| InChI | InChI=1S/C10H16O/c1-8(9(2)11-3)10-6-4-5-7-10/h4-6,8-9H,7H2,1-3H3 |
| InChIKey | RQVGEAOESDFVSM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 152.24 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |