C8H11NO2 — CID 59567112
(3R)-3-amino-3-cyclopenta-1,3-dien-1-ylpropanoic acid (PubChem CID 59567112) has the molecular formula C8H11NO2 and a molecular weight of 153.18 g/mol. Its IUPAC name is (3R)-3-amino-3-cyclopenta-1,3-dien-1-ylpropanoic acid.
| Compound Name | (3R)-3-amino-3-cyclopenta-1,3-dien-1-ylpropanoic acid |
|---|---|
| PubChem CID | 59567112 |
| Molecular Formula | C8H11NO2 |
| Molecular Weight | 153.18 g/mol |
| Exact Mass | 153.08 |
| IUPAC Name | (3R)-3-amino-3-cyclopenta-1,3-dien-1-ylpropanoic acid |
| SMILES | N[C@H](CC(=O)O)C1=CC=CC1 |
| InChI | InChI=1S/C8H11NO2/c9-7(5-8(10)11)6-3-1-2-4-6/h1-3,7H,4-5,9H2,(H,10,11)/t7-/m1/s1 |
| InChIKey | YLTLCPIZESGBQQ-SSDOTTSWSA-N |
| XLogP | 0.67 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.18 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |