C12H18 — CID 144585615
(1E,3Z)-1-methyl-3-propylcycloocta-1,3,5-triene (PubChem CID 144585615) has the molecular formula C12H18 and a molecular weight of 162.28 g/mol. Its IUPAC name is (1E,3Z)-1-methyl-3-propylcycloocta-1,3,5-triene.
| Compound Name | (1E,3Z)-1-methyl-3-propylcycloocta-1,3,5-triene |
|---|---|
| PubChem CID | 144585615 |
| Molecular Formula | C12H18 |
| Molecular Weight | 162.28 g/mol |
| Exact Mass | 162.14 |
| IUPAC Name | (1E,3Z)-1-methyl-3-propylcycloocta-1,3,5-triene |
| SMILES | CCCC1=C/C=CCC/C(C)=C\1 |
| InChI | InChI=1S/C12H18/c1-3-7-12-9-6-4-5-8-11(2)10-12/h4,6,9-10H,3,5,7-8H2,1-2H3/b6-4?,11-10-,12-9- |
| InChIKey | WBRIDNOQVUNLLR-JNJQPNCWSA-N |
| XLogP | 4.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.28 |
| LogP ≤ 5 | 4.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |