About 2-ethyl-3aH-indene
2-ethyl-3aH-indene (PubChem CID 23399067) has the molecular formula C11H12
and a molecular weight of 144.22 g/mol. Its IUPAC name is 2-ethyl-3aH-indene.
Molecular Properties
| Compound Name | 2-ethyl-3aH-indene |
| PubChem CID | 23399067 |
| Molecular Formula | C11H12 |
| Molecular Weight | 144.22 g/mol |
| Exact Mass | 144.09 |
| IUPAC Name | 2-ethyl-3aH-indene |
| SMILES | CCC1=CC2C=CC=CC2=C1 |
| InChI | InChI=1S/C11H12/c1-2-9-7-10-5-3-4-6-11(10)8-9/h3-8,10H,2H2,1H3 |
| InChIKey | OGIGWXKPJBRCLD-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 144.22 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-ethyl-3aH-indene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-3aH-indene?
The IUPAC name of 2-ethyl-3aH-indene (CID 23399067) is 2-ethyl-3aH-indene.
What is the SMILES notation for 2-ethyl-3aH-indene?
The canonical SMILES for 2-ethyl-3aH-indene is CCC1=CC2C=CC=CC2=C1.
What is the InChIKey of 2-ethyl-3aH-indene?
The InChIKey is OGIGWXKPJBRCLD-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12/c1-2-9-7-10-5-3-4-6-11(10)8-9/h3-8,10H,2H2,1H3.
What are the key properties of 2-ethyl-3aH-indene?
2-ethyl-3aH-indene has a molecular weight of 144.22 g/mol, XLogP of 3.01, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-3aH-indene is sourced from PubChem (CID 23399067), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).