C14H20Si — CID 101180935
cyclopenta-2,4-dien-1-yl-(3-ethylcyclopenta-2,4-dien-1-yl)-dimethylsilane (PubChem CID 101180935) has the molecular formula C14H20Si and a molecular weight of 216.40 g/mol. Its IUPAC name is cyclopenta-2,4-dien-1-yl-(3-ethylcyclopenta-2,4-dien-1-yl)-dimethylsilane.
| Compound Name | cyclopenta-2,4-dien-1-yl-(3-ethylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
|---|---|
| PubChem CID | 101180935 |
| Molecular Formula | C14H20Si |
| Molecular Weight | 216.40 g/mol |
| Exact Mass | 216.13 |
| IUPAC Name | cyclopenta-2,4-dien-1-yl-(3-ethylcyclopenta-2,4-dien-1-yl)-dimethylsilane |
| SMILES | CCC1=CC([Si](C)(C)C2C=CC=C2)C=C1 |
| InChI | InChI=1S/C14H20Si/c1-4-12-9-10-14(11-12)15(2,3)13-7-5-6-8-13/h5-11,13-14H,4H2,1-3H3 |
| InChIKey | KKLUDYSCPRCTDJ-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 216.40 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|