C14H14O — CID 142358862
3-ethyl-4a,9b-dihydrodibenzofuran (PubChem CID 142358862) has the molecular formula C14H14O and a molecular weight of 198.26 g/mol. Its IUPAC name is 3-ethyl-4a,9b-dihydrodibenzofuran.
| Compound Name | 3-ethyl-4a,9b-dihydrodibenzofuran |
|---|---|
| PubChem CID | 142358862 |
| Molecular Formula | C14H14O |
| Molecular Weight | 198.26 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | 3-ethyl-4a,9b-dihydrodibenzofuran |
| SMILES | CCC1=CC2Oc3ccccc3C2C=C1 |
| InChI | InChI=1S/C14H14O/c1-2-10-7-8-12-11-5-3-4-6-13(11)15-14(12)9-10/h3-9,12,14H,2H2,1H3 |
| InChIKey | XSMZVLASFKHLDH-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.26 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |