About 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran
1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran (PubChem CID 170227599) has the molecular formula C20H19IO
and a molecular weight of 402.28 g/mol. Its IUPAC name is 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran.
Molecular Properties
| Compound Name | 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran |
| PubChem CID | 170227599 |
| Molecular Formula | C20H19IO |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran |
| SMILES | CCC(I)Cc1cccc2c1C1C=c3ccccc3=CC1O2 |
| InChI | InChI=1S/C20H19IO/c1-2-16(21)10-15-8-5-9-18-20(15)17-11-13-6-3-4-7-14(13)12-19(17)22-18/h3-9,11-12,16-17,19H,2,10H2,1H3 |
| InChIKey | AJDLLMWTBCQWDW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran?
The IUPAC name of 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran (CID 170227599) is 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran.
What is the SMILES notation for 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran?
The canonical SMILES for 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran is CCC(I)Cc1cccc2c1C1C=c3ccccc3=CC1O2.
What is the InChIKey of 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran?
The InChIKey is AJDLLMWTBCQWDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H19IO/c1-2-16(21)10-15-8-5-9-18-20(15)17-11-13-6-3-4-7-14(13)12-19(17)22-18/h3-9,11-12,16-17,19H,2,10H2,1H3.
What are the key properties of 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran?
1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran has a molecular weight of 402.28 g/mol, XLogP of 3.56, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran is sourced from PubChem (CID 170227599), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).