C20H19IO — CID 170227599
1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran (PubChem CID 170227599) has the molecular formula C20H19IO and a molecular weight of 402.28 g/mol. Its IUPAC name is 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran.
| Compound Name | 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran |
|---|---|
| PubChem CID | 170227599 |
| Molecular Formula | C20H19IO |
| Molecular Weight | 402.28 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | 1-(2-iodobutyl)-5a,11a-dihydronaphtho[2,3-b][1]benzofuran |
| SMILES | CCC(I)Cc1cccc2c1C1C=c3ccccc3=CC1O2 |
| InChI | InChI=1S/C20H19IO/c1-2-16(21)10-15-8-5-9-18-20(15)17-11-13-6-3-4-7-14(13)12-19(17)22-18/h3-9,11-12,16-17,19H,2,10H2,1H3 |
| InChIKey | AJDLLMWTBCQWDW-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.28 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|