C21H30O — CID 50919316
(6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene (PubChem CID 50919316) has the molecular formula C21H30O and a molecular weight of 298.47 g/mol. Its IUPAC name is (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene.
| Compound Name | (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene |
|---|---|
| PubChem CID | 50919316 |
| Molecular Formula | C21H30O |
| Molecular Weight | 298.47 g/mol |
| Exact Mass | 298.23 |
| IUPAC Name | (6aR,10aR)-6,6,9-trimethyl-3-pentyl-6a,7,8,10a-tetrahydrobenzo[c]chromene |
| SMILES | CCCCCc1ccc2c(c1)OC(C)(C)[C@@H]1CCC(C)=C[C@@H]21 |
| InChI | InChI=1S/C21H30O/c1-5-6-7-8-16-10-11-17-18-13-15(2)9-12-19(18)21(3,4)22-20(17)14-16/h10-11,13-14,18-19H,5-9,12H2,1-4H3/t18-,19+/m0/s1 |
| InChIKey | AIOSXAOKGBOYPS-RBUKOAKNSA-N |
| XLogP | 6.03 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.47 |
| LogP ≤ 5 | 6.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|