C13H10O3 — CID 50742130
3-hydroxy-4a,9a-dihydroxanthen-9-one (PubChem CID 50742130) has the molecular formula C13H10O3 and a molecular weight of 214.22 g/mol. Its IUPAC name is 3-hydroxy-4a,9a-dihydroxanthen-9-one.
| Compound Name | 3-hydroxy-4a,9a-dihydroxanthen-9-one |
|---|---|
| PubChem CID | 50742130 |
| Molecular Formula | C13H10O3 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.06 |
| IUPAC Name | 3-hydroxy-4a,9a-dihydroxanthen-9-one |
| SMILES | O=C1c2ccccc2OC2C=C(O)C=CC12 |
| InChI | InChI=1S/C13H10O3/c14-8-5-6-10-12(7-8)16-11-4-2-1-3-9(11)13(10)15/h1-7,10,12,14H |
| InChIKey | WNKRTSKKTLXOMW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |