C14H21GeSi — CID 136672081
CID 136672081 (PubChem CID 136672081) has the molecular formula C14H21GeSi and a molecular weight of 290.02 g/mol.
| Compound Name | CID 136672081 |
|---|---|
| PubChem CID | 136672081 |
| Molecular Formula | C14H21GeSi |
| Molecular Weight | 290.02 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | — |
| SMILES | C[Ge](C)C1=CC=CC1[Si](C)(C)C1C=CC=C1 |
| InChI | InChI=1S/C14H21GeSi/c1-15(2)13-10-7-11-14(13)16(3,4)12-8-5-6-9-12/h5-12,14H,1-4H3 |
| InChIKey | GYHRJNFPRKYGTJ-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.02 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|