C12H14Cl2Si — CID 139699557
dichloro-bis(2-methylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 139699557) has the molecular formula C12H14Cl2Si and a molecular weight of 257.24 g/mol. Its IUPAC name is dichloro-bis(2-methylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | dichloro-bis(2-methylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 139699557 |
| Molecular Formula | C12H14Cl2Si |
| Molecular Weight | 257.24 g/mol |
| Exact Mass | 256.02 |
| IUPAC Name | dichloro-bis(2-methylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC=CC1[Si](Cl)(Cl)C1C=CC=C1C |
| InChI | InChI=1S/C12H14Cl2Si/c1-9-5-3-7-11(9)15(13,14)12-8-4-6-10(12)2/h3-8,11-12H,1-2H3 |
| InChIKey | LQKORECHSWTZJZ-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.24 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|