C6H10Si — CID 150982672
(2-methylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 150982672) has the molecular formula C6H10Si and a molecular weight of 110.23 g/mol. Its IUPAC name is (2-methylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | (2-methylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 150982672 |
| Molecular Formula | C6H10Si |
| Molecular Weight | 110.23 g/mol |
| Exact Mass | 110.06 |
| IUPAC Name | (2-methylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | CC1=CC=CC1[SiH3] |
| InChI | InChI=1S/C6H10Si/c1-5-3-2-4-6(5)7/h2-4,6H,1,7H3 |
| InChIKey | LQKSMZTZBJKHKK-UHFFFAOYSA-N |
| XLogP | 0.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 110.23 |
| LogP ≤ 5 | 0.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|