C8H10 — CID 123235064
2-methylbicyclo[4.1.0]hepta-2,4-diene (PubChem CID 123235064) has the molecular formula C8H10 and a molecular weight of 106.17 g/mol. Its IUPAC name is 2-methylbicyclo[4.1.0]hepta-2,4-diene.
| Compound Name | 2-methylbicyclo[4.1.0]hepta-2,4-diene |
|---|---|
| PubChem CID | 123235064 |
| Molecular Formula | C8H10 |
| Molecular Weight | 106.17 g/mol |
| Exact Mass | 106.08 |
| IUPAC Name | 2-methylbicyclo[4.1.0]hepta-2,4-diene |
| SMILES | CC1=CC=CC2CC12 |
| InChI | InChI=1S/C8H10/c1-6-3-2-4-7-5-8(6)7/h2-4,7-8H,5H2,1H3 |
| InChIKey | PZPBWWRZFYYGTL-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 106.17 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |