About 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan
3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan (PubChem CID 143157689) has the molecular formula C11H10O
and a molecular weight of 158.20 g/mol. Its IUPAC name is 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan.
Molecular Properties
| Compound Name | 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan |
| PubChem CID | 143157689 |
| Molecular Formula | C11H10O |
| Molecular Weight | 158.20 g/mol |
| Exact Mass | 158.07 |
| IUPAC Name | 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan |
| SMILES | C1=CC2CC2C(c2ccoc2)=C1 |
| InChI | InChI=1S/C11H10O/c1-2-8-6-11(8)10(3-1)9-4-5-12-7-9/h1-5,7-8,11H,6H2 |
| InChIKey | AMEYIEINFJDDRF-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.20 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan?
The IUPAC name of 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan (CID 143157689) is 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan.
What is the SMILES notation for 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan?
The canonical SMILES for 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan is C1=CC2CC2C(c2ccoc2)=C1.
What is the InChIKey of 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan?
The InChIKey is AMEYIEINFJDDRF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10O/c1-2-8-6-11(8)10(3-1)9-4-5-12-7-9/h1-5,7-8,11H,6H2.
What are the key properties of 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan?
3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan has a molecular weight of 158.20 g/mol, XLogP of 2.87, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(2-bicyclo[4.1.0]hepta-2,4-dienyl)furan is sourced from PubChem (CID 143157689), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).