C11H22Si2 — CID 11987086
trimethyl-(2-trimethylsilylcyclopenta-2,4-dien-1-yl)silane (PubChem CID 11987086) has the molecular formula C11H22Si2 and a molecular weight of 210.47 g/mol. Its IUPAC name is trimethyl-(2-trimethylsilylcyclopenta-2,4-dien-1-yl)silane.
| Compound Name | trimethyl-(2-trimethylsilylcyclopenta-2,4-dien-1-yl)silane |
|---|---|
| PubChem CID | 11987086 |
| Molecular Formula | C11H22Si2 |
| Molecular Weight | 210.47 g/mol |
| Exact Mass | 210.13 |
| IUPAC Name | trimethyl-(2-trimethylsilylcyclopenta-2,4-dien-1-yl)silane |
| SMILES | C[Si](C)(C)C1=CC=CC1[Si](C)(C)C |
| InChI | InChI=1S/C11H22Si2/c1-12(2,3)10-8-7-9-11(10)13(4,5)6/h7-10H,1-6H3 |
| InChIKey | GWSMJEWNOBFPKS-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.47 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|