C18H26NO2PSi — CID 101390305
[5-[(4S,5R)-3,4-dimethyl-2-oxido-5-phenyl-1,3,2-oxazaphospholidin-2-ium-2-yl]cyclopenta-1,3-dien-1-yl]-trimethylsilane (PubChem CID 101390305) has the molecular formula C18H26NO2PSi and a molecular weight of 347.47 g/mol. Its IUPAC name is [5-[(4S,5R)-3,4-dimethyl-2-oxido-5-phenyl-1,3,2-oxazaphospholidin-2-ium-2-yl]cyclopenta-1,3-dien-1-yl]-trimethylsilane.
| Compound Name | [5-[(4S,5R)-3,4-dimethyl-2-oxido-5-phenyl-1,3,2-oxazaphospholidin-2-ium-2-yl]cyclopenta-1,3-dien-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101390305 |
| Molecular Formula | C18H26NO2PSi |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | [5-[(4S,5R)-3,4-dimethyl-2-oxido-5-phenyl-1,3,2-oxazaphospholidin-2-ium-2-yl]cyclopenta-1,3-dien-1-yl]-trimethylsilane |
| SMILES | C[C@H]1[C@@H](c2ccccc2)O[P+]([O-])(C2C=CC=C2[Si](C)(C)C)N1C |
| InChI | InChI=1S/C18H26NO2PSi/c1-14-18(15-10-7-6-8-11-15)21-22(20,19(14)2)16-12-9-13-17(16)23(3,4)5/h6-14,16,18H,1-5H3/t14-,16?,18-,22?/m0/s1 |
| InChIKey | KJXDUBRNQURMMK-TWGDKQRHSA-N |
| XLogP | 3.94 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|