C12H19N2OPS — CID 58445883
(4R,5S)-N,N,3,4-tetramethyl-5-phenyl-2-sulfanylidene-1,3,2λ5-oxazaphospholidin-2-amine (PubChem CID 58445883) has the molecular formula C12H19N2OPS and a molecular weight of 270.34 g/mol. Its IUPAC name is (4R,5S)-N,N,3,4-tetramethyl-5-phenyl-2-sulfanylidene-1,3,2λ5-oxazaphospholidin-2-amine.
| Compound Name | (4R,5S)-N,N,3,4-tetramethyl-5-phenyl-2-sulfanylidene-1,3,2λ5-oxazaphospholidin-2-amine |
|---|---|
| PubChem CID | 58445883 |
| Molecular Formula | C12H19N2OPS |
| Molecular Weight | 270.34 g/mol |
| Exact Mass | 270.10 |
| IUPAC Name | (4R,5S)-N,N,3,4-tetramethyl-5-phenyl-2-sulfanylidene-1,3,2λ5-oxazaphospholidin-2-amine |
| SMILES | C[C@@H]1[C@H](c2ccccc2)OP(=S)(N(C)C)N1C |
| InChI | InChI=1S/C12H19N2OPS/c1-10-12(11-8-6-5-7-9-11)15-16(17,13(2)3)14(10)4/h5-10,12H,1-4H3/t10-,12-,16?/m1/s1 |
| InChIKey | IUTKDHFVOYTFCY-FCLRLEBCSA-N |
| XLogP | 2.86 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.34 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|