C16H23NO2SSi — CID 162396933
N-[(1R)-1-phenylethyl]-5-trimethylsilylcyclopenta-1,3-diene-1-sulfonamide (PubChem CID 162396933) has the molecular formula C16H23NO2SSi and a molecular weight of 321.52 g/mol. Its IUPAC name is N-[(1R)-1-phenylethyl]-5-trimethylsilylcyclopenta-1,3-diene-1-sulfonamide.
| Compound Name | N-[(1R)-1-phenylethyl]-5-trimethylsilylcyclopenta-1,3-diene-1-sulfonamide |
|---|---|
| PubChem CID | 162396933 |
| Molecular Formula | C16H23NO2SSi |
| Molecular Weight | 321.52 g/mol |
| Exact Mass | 321.12 |
| IUPAC Name | N-[(1R)-1-phenylethyl]-5-trimethylsilylcyclopenta-1,3-diene-1-sulfonamide |
| SMILES | C[C@@H](NS(=O)(=O)C1=CC=CC1[Si](C)(C)C)c1ccccc1 |
| InChI | InChI=1S/C16H23NO2SSi/c1-13(14-9-6-5-7-10-14)17-20(18,19)15-11-8-12-16(15)21(2,3)4/h5-13,16-17H,1-4H3/t13-,16?/m1/s1 |
| InChIKey | JSEMOLISHHYGEN-JBZHPUCOSA-N |
| XLogP | 3.83 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.52 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|