C12H15N5O2S — CID 61328714
2-hydrazinyl-N-(1-phenylethyl)pyrimidine-5-sulfonamide (PubChem CID 61328714) has the molecular formula C12H15N5O2S and a molecular weight of 293.35 g/mol. Its IUPAC name is 2-hydrazinyl-N-(1-phenylethyl)pyrimidine-5-sulfonamide.
| Compound Name | 2-hydrazinyl-N-(1-phenylethyl)pyrimidine-5-sulfonamide |
|---|---|
| PubChem CID | 61328714 |
| Molecular Formula | C12H15N5O2S |
| Molecular Weight | 293.35 g/mol |
| Exact Mass | 293.09 |
| IUPAC Name | 2-hydrazinyl-N-(1-phenylethyl)pyrimidine-5-sulfonamide |
| SMILES | CC(NS(=O)(=O)c1cnc(NN)nc1)c1ccccc1 |
| InChI | InChI=1S/C12H15N5O2S/c1-9(10-5-3-2-4-6-10)17-20(18,19)11-7-14-12(16-13)15-8-11/h2-9,17H,13H2,1H3,(H,14,15,16) |
| InChIKey | JXDMXDOBPKPRFC-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 110.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.35 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|