C18H18N4O2S — CID 171387685
4-(2-aminopyrimidin-5-yl)-N-[(1S)-1-phenylethyl]benzenesulfonamide (PubChem CID 171387685) has the molecular formula C18H18N4O2S and a molecular weight of 354.44 g/mol. Its IUPAC name is 4-(2-aminopyrimidin-5-yl)-N-[(1S)-1-phenylethyl]benzenesulfonamide.
| Compound Name | 4-(2-aminopyrimidin-5-yl)-N-[(1S)-1-phenylethyl]benzenesulfonamide |
|---|---|
| PubChem CID | 171387685 |
| Molecular Formula | C18H18N4O2S |
| Molecular Weight | 354.44 g/mol |
| Exact Mass | 354.12 |
| IUPAC Name | 4-(2-aminopyrimidin-5-yl)-N-[(1S)-1-phenylethyl]benzenesulfonamide |
| SMILES | C[C@H](NS(=O)(=O)c1ccc(-c2cnc(N)nc2)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H18N4O2S/c1-13(14-5-3-2-4-6-14)22-25(23,24)17-9-7-15(8-10-17)16-11-20-18(19)21-12-16/h2-13,22H,1H3,(H2,19,20,21)/t13-/m0/s1 |
| InChIKey | KKSTXYGCBYJNPY-ZDUSSCGKSA-N |
| XLogP | 2.77 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.44 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |