C28H62Si6 — CID 139054439
trimethyl-[(1S,2R,3R,4S,5R,8R)-1,3,4,5,8-pentakis(trimethylsilyl)-1,2,3,4,5,8-hexahydronaphthalen-2-yl]silane (PubChem CID 139054439) has the molecular formula C28H62Si6 and a molecular weight of 567.32 g/mol. Its IUPAC name is trimethyl-[(1S,2R,3R,4S,5R,8R)-1,3,4,5,8-pentakis(trimethylsilyl)-1,2,3,4,5,8-hexahydronaphthalen-2-yl]silane.
| Compound Name | trimethyl-[(1S,2R,3R,4S,5R,8R)-1,3,4,5,8-pentakis(trimethylsilyl)-1,2,3,4,5,8-hexahydronaphthalen-2-yl]silane |
|---|---|
| PubChem CID | 139054439 |
| Molecular Formula | C28H62Si6 |
| Molecular Weight | 567.32 g/mol |
| Exact Mass | 566.35 |
| IUPAC Name | trimethyl-[(1S,2R,3R,4S,5R,8R)-1,3,4,5,8-pentakis(trimethylsilyl)-1,2,3,4,5,8-hexahydronaphthalen-2-yl]silane |
| SMILES | C[Si](C)(C)[C@H]1[C@H]([Si](C)(C)C)[C@@H]([Si](C)(C)C)C2=C([C@H]([Si](C)(C)C)C=C[C@H]2[Si](C)(C)C)[C@@H]1[Si](C)(C)C |
| InChI | InChI=1S/C28H62Si6/c1-29(2,3)21-19-20-22(30(4,5)6)24-23(21)25(31(7,8)9)27(33(13,14)15)28(34(16,17)18)26(24)32(10,11)12/h19-22,25-28H,1-18H3/t21-,22-,25+,26+,27-,28-/m1/s1 |
| InChIKey | BNPUQXLYKGJUSR-QPRBUEJRSA-N |
| XLogP | 11.12 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 567.32 |
| LogP ≤ 5 | 11.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|