C23H44Si4 — CID 101081148
[2-cyclopenta-2,4-dien-1-yl-4,5,6-tris(trimethylsilyl)cyclohexa-1,3-dien-1-yl]-trimethylsilane (PubChem CID 101081148) has the molecular formula C23H44Si4 and a molecular weight of 432.95 g/mol. Its IUPAC name is [2-cyclopenta-2,4-dien-1-yl-4,5,6-tris(trimethylsilyl)cyclohexa-1,3-dien-1-yl]-trimethylsilane.
| Compound Name | [2-cyclopenta-2,4-dien-1-yl-4,5,6-tris(trimethylsilyl)cyclohexa-1,3-dien-1-yl]-trimethylsilane |
|---|---|
| PubChem CID | 101081148 |
| Molecular Formula | C23H44Si4 |
| Molecular Weight | 432.95 g/mol |
| Exact Mass | 432.25 |
| IUPAC Name | [2-cyclopenta-2,4-dien-1-yl-4,5,6-tris(trimethylsilyl)cyclohexa-1,3-dien-1-yl]-trimethylsilane |
| SMILES | C[Si](C)(C)C1=CC(C2C=CC=C2)=C([Si](C)(C)C)C([Si](C)(C)C)C1[Si](C)(C)C |
| InChI | InChI=1S/C23H44Si4/c1-24(2,3)20-17-19(18-15-13-14-16-18)21(25(4,5)6)23(27(10,11)12)22(20)26(7,8)9/h13-18,22-23H,1-12H3 |
| InChIKey | XFRPFWYGCWHFLJ-UHFFFAOYSA-N |
| XLogP | 8.14 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.95 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|