C10H22O2Si2 — CID 101353353
(1S,2R)-3,4-bis(trimethylsilyl)cyclobut-3-ene-1,2-diol (PubChem CID 101353353) has the molecular formula C10H22O2Si2 and a molecular weight of 230.46 g/mol. Its IUPAC name is (1S,2R)-3,4-bis(trimethylsilyl)cyclobut-3-ene-1,2-diol.
| Compound Name | (1S,2R)-3,4-bis(trimethylsilyl)cyclobut-3-ene-1,2-diol |
|---|---|
| PubChem CID | 101353353 |
| Molecular Formula | C10H22O2Si2 |
| Molecular Weight | 230.46 g/mol |
| Exact Mass | 230.12 |
| IUPAC Name | (1S,2R)-3,4-bis(trimethylsilyl)cyclobut-3-ene-1,2-diol |
| SMILES | C[Si](C)(C)C1=C([Si](C)(C)C)[C@H](O)[C@@H]1O |
| InChI | InChI=1S/C10H22O2Si2/c1-13(2,3)9-7(11)8(12)10(9)14(4,5)6/h7-8,11-12H,1-6H3/t7-,8+ |
| InChIKey | FFNUYBJNTUTSFP-OCAPTIKFSA-N |
| XLogP | 1.77 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.46 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|