C5H8O3 — CID 10953469
(3R,4R)-3-hydroxy-4-methyloxolan-2-one (PubChem CID 10953469) has the molecular formula C5H8O3 and a molecular weight of 116.12 g/mol. Its IUPAC name is (3R,4R)-3-hydroxy-4-methyloxolan-2-one.
| Compound Name | (3R,4R)-3-hydroxy-4-methyloxolan-2-one |
|---|---|
| PubChem CID | 10953469 |
| Molecular Formula | C5H8O3 |
| Molecular Weight | 116.12 g/mol |
| Exact Mass | 116.05 |
| IUPAC Name | (3R,4R)-3-hydroxy-4-methyloxolan-2-one |
| SMILES | C[C@@H]1COC(=O)[C@@H]1O |
| InChI | InChI=1S/C5H8O3/c1-3-2-8-5(7)4(3)6/h3-4,6H,2H2,1H3/t3-,4-/m1/s1 |
| InChIKey | GFPAFTLIWBGZMF-QWWZWVQMSA-N |
| XLogP | -0.46 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 116.12 |
| LogP ≤ 5 | -0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |