C7H11NO3 — CID 131037907
N-[(3S,4R)-4-methyl-2-oxooxolan-3-yl]acetamide (PubChem CID 131037907) has the molecular formula C7H11NO3 and a molecular weight of 157.17 g/mol. Its IUPAC name is N-[(3S,4R)-4-methyl-2-oxooxolan-3-yl]acetamide.
| Compound Name | N-[(3S,4R)-4-methyl-2-oxooxolan-3-yl]acetamide |
|---|---|
| PubChem CID | 131037907 |
| Molecular Formula | C7H11NO3 |
| Molecular Weight | 157.17 g/mol |
| Exact Mass | 157.07 |
| IUPAC Name | N-[(3S,4R)-4-methyl-2-oxooxolan-3-yl]acetamide |
| SMILES | CC(=O)N[C@@H]1C(=O)OC[C@@H]1C |
| InChI | InChI=1S/C7H11NO3/c1-4-3-11-7(10)6(4)8-5(2)9/h4,6H,3H2,1-2H3,(H,8,9)/t4-,6-/m0/s1 |
| InChIKey | ABNUGWRZSYVEEW-NJGYIYPDSA-N |
| XLogP | -0.32 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 157.17 |
| LogP ≤ 5 | -0.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |