C7H12O6 — CID 118468529
(3R,4R,5S,6R)-3,4,5,6-tetrahydroxyoxocan-2-one (PubChem CID 118468529) has the molecular formula C7H12O6 and a molecular weight of 192.17 g/mol. Its IUPAC name is (3R,4R,5S,6R)-3,4,5,6-tetrahydroxyoxocan-2-one.
| Compound Name | (3R,4R,5S,6R)-3,4,5,6-tetrahydroxyoxocan-2-one |
|---|---|
| PubChem CID | 118468529 |
| Molecular Formula | C7H12O6 |
| Molecular Weight | 192.17 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | (3R,4R,5S,6R)-3,4,5,6-tetrahydroxyoxocan-2-one |
| SMILES | O=C1OCC[C@@H](O)[C@H](O)[C@@H](O)[C@H]1O |
| InChI | InChI=1S/C7H12O6/c8-3-1-2-13-7(12)6(11)5(10)4(3)9/h3-6,8-11H,1-2H2/t3-,4+,5-,6-/m1/s1 |
| InChIKey | KQFRGMNLNKQOCK-JGWLITMVSA-N |
| XLogP | -2.62 |
| TPSA | 107.22 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.17 |
| LogP ≤ 5 | -2.62 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |