About 3-hydroxyoxolan-2-one;3-methyloxolan-2-one
3-hydroxyoxolan-2-one;3-methyloxolan-2-one (PubChem CID 160588436) has the molecular formula C9H14O5
and a molecular weight of 202.21 g/mol. Its IUPAC name is 3-hydroxyoxolan-2-one;3-methyloxolan-2-one.
Molecular Properties
| Compound Name | 3-hydroxyoxolan-2-one;3-methyloxolan-2-one |
| PubChem CID | 160588436 |
| Molecular Formula | C9H14O5 |
| Molecular Weight | 202.21 g/mol |
| Exact Mass | 202.08 |
| IUPAC Name | 3-hydroxyoxolan-2-one;3-methyloxolan-2-one |
| SMILES | CC1CCOC1=O.O=C1OCCC1O |
| InChI | InChI=1S/C5H8O2.C4H6O3/c1-4-2-3-7-5(4)6;5-3-1-2-7-4(3)6/h4H,2-3H2,1H3;3,5H,1-2H2 |
| InChIKey | RCRUTRHPRGXUDS-UHFFFAOYSA-N |
| XLogP | -0.14 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.21 |
| LogP ≤ 5 | -0.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 3-hydroxyoxolan-2-one;3-methyloxolan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxyoxolan-2-one;3-methyloxolan-2-one?
The IUPAC name of 3-hydroxyoxolan-2-one;3-methyloxolan-2-one (CID 160588436) is 3-hydroxyoxolan-2-one;3-methyloxolan-2-one.
What is the SMILES notation for 3-hydroxyoxolan-2-one;3-methyloxolan-2-one?
The canonical SMILES for 3-hydroxyoxolan-2-one;3-methyloxolan-2-one is CC1CCOC1=O.O=C1OCCC1O.
What is the InChIKey of 3-hydroxyoxolan-2-one;3-methyloxolan-2-one?
The InChIKey is RCRUTRHPRGXUDS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8O2.C4H6O3/c1-4-2-3-7-5(4)6;5-3-1-2-7-4(3)6/h4H,2-3H2,1H3;3,5H,1-2H2.
What are the key properties of 3-hydroxyoxolan-2-one;3-methyloxolan-2-one?
3-hydroxyoxolan-2-one;3-methyloxolan-2-one has a molecular weight of 202.21 g/mol, XLogP of -0.14, 0 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxyoxolan-2-one;3-methyloxolan-2-one is sourced from PubChem (CID 160588436), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).