C4H5FO3 — CID 131176048
(3R,4R)-4-fluoro-3-hydroxyoxolan-2-one (PubChem CID 131176048) has the molecular formula C4H5FO3 and a molecular weight of 120.08 g/mol. Its IUPAC name is (3R,4R)-4-fluoro-3-hydroxyoxolan-2-one.
| Compound Name | (3R,4R)-4-fluoro-3-hydroxyoxolan-2-one |
|---|---|
| PubChem CID | 131176048 |
| Molecular Formula | C4H5FO3 |
| Molecular Weight | 120.08 g/mol |
| Exact Mass | 120.02 |
| IUPAC Name | (3R,4R)-4-fluoro-3-hydroxyoxolan-2-one |
| SMILES | O=C1OC[C@@H](F)[C@@H]1O |
| InChI | InChI=1S/C4H5FO3/c5-2-1-8-4(7)3(2)6/h2-3,6H,1H2/t2-,3+/m1/s1 |
| InChIKey | YCIGZYLLSDHORG-GBXIJSLDSA-N |
| XLogP | -0.76 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.08 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |